C29H37N3O3 — CID 16992298
N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide (PubChem CID 16992298) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide.
| Compound Name | N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 16992298 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CCCCCNC(=O)C=C)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C29H37N3O3/c1-4-13-23-17-18-26(27(22-23)34-3)35-21-12-11-20-32-25-15-9-8-14-24(25)31-28(32)16-7-6-10-19-30-29(33)5-2/h4-5,8-9,14-15,17-18,22H,1-2,6-7,10-13,16,19-21H2,3H3,(H,30,33) |
| InChIKey | UPYKJPUMZKVEAI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|