C30H41N3O3 — CID 16981062
2-ethyl-N-[3-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]propyl]butanamide (PubChem CID 16981062) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-ethyl-N-[3-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]propyl]butanamide.
| Compound Name | 2-ethyl-N-[3-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]propyl]butanamide |
|---|---|
| PubChem CID | 16981062 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | 2-ethyl-N-[3-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]propyl]butanamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CCCNC(=O)C(CC)CC)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C30H41N3O3/c1-5-13-23-17-18-27(28(22-23)35-4)36-21-11-10-20-33-26-15-9-8-14-25(26)32-29(33)16-12-19-31-30(34)24(6-2)7-3/h5,8-9,14-15,17-18,22,24H,1,6-7,10-13,16,19-21H2,2-4H3,(H,31,34) |
| InChIKey | QEZNXUSXUJUFAY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|