C32H37N3O4 — CID 16992892
N-[5-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-phenoxyacetamide (PubChem CID 16992892) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is N-[5-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-phenoxyacetamide.
| Compound Name | N-[5-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 16992892 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | N-[5-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-phenoxyacetamide |
| SMILES | C=CCc1ccc(OCCn2c(CCCCCNC(=O)COc3ccccc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C32H37N3O4/c1-3-12-25-18-19-29(30(23-25)37-2)38-22-21-35-28-16-10-9-15-27(28)34-31(35)17-8-5-11-20-33-32(36)24-39-26-13-6-4-7-14-26/h3-4,6-7,9-10,13-16,18-19,23H,1,5,8,11-12,17,20-22,24H2,2H3,(H,33,36) |
| InChIKey | XHNZKJGIYYJXNL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|