C28H29N3O4 — CID 16970965
N-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-phenoxyacetamide (PubChem CID 16970965) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-phenoxyacetamide.
| Compound Name | N-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 16970965 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]methyl]-2-phenoxyacetamide |
| SMILES | C=CCc1ccc(OCCn2c(CNC(=O)COc3ccccc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C28H29N3O4/c1-3-9-21-14-15-25(26(18-21)33-2)34-17-16-31-24-13-8-7-12-23(24)30-27(31)19-29-28(32)20-35-22-10-5-4-6-11-22/h3-8,10-15,18H,1,9,16-17,19-20H2,2H3,(H,29,32) |
| InChIKey | WQYGTYHAIKNKIK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|