C30H33N3O4 — CID 17007678
2-methoxy-N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17007678) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-methoxy-N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 2-methoxy-N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17007678 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 2-methoxy-N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CNC(=O)c3ccccc3OC)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C30H33N3O4/c1-4-11-22-16-17-27(28(20-22)36-3)37-19-10-9-18-33-25-14-7-6-13-24(25)32-29(33)21-31-30(34)23-12-5-8-15-26(23)35-2/h4-8,12-17,20H,1,9-11,18-19,21H2,2-3H3,(H,31,34) |
| InChIKey | DXGPKPLYGYNDAF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|