C27H29N3O3S — CID 16973835
N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide (PubChem CID 16973835) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide.
| Compound Name | N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16973835 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]methyl]thiophene-2-carboxamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CNC(=O)c3cccs3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C27H29N3O3S/c1-3-9-20-13-14-23(24(18-20)32-2)33-16-7-6-15-30-22-11-5-4-10-21(22)29-26(30)19-28-27(31)25-12-8-17-34-25/h3-5,8,10-14,17-18H,1,6-7,9,15-16,19H2,2H3,(H,28,31) |
| InChIKey | OBURMSDGEMFWTI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|