C31H35N3O6 — CID 16977029
3,4,5-trimethoxy-N-[2-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16977029) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16977029 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[1-[2-(2-methoxy-4-prop-2-enylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C=CCc1ccc(OCCn2c(CCNC(=O)c3cc(OC)c(OC)c(OC)c3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C31H35N3O6/c1-6-9-21-12-13-25(26(18-21)36-2)40-17-16-34-24-11-8-7-10-23(24)33-29(34)14-15-32-31(35)22-19-27(37-3)30(39-5)28(20-22)38-4/h6-8,10-13,18-20H,1,9,14-17H2,2-5H3,(H,32,35) |
| InChIKey | HUEVQQVFKCIKKS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|