C31H35N3O4 — CID 16978171
3-methoxy-N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16978171) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-methoxy-N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16978171 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 3-methoxy-N-[2-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(CCNC(=O)c3cccc(OC)c3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C31H35N3O4/c1-4-10-23-15-16-28(29(21-23)37-3)38-20-8-7-19-34-27-14-6-5-13-26(27)33-30(34)17-18-32-31(35)24-11-9-12-25(22-24)36-2/h4-6,9-16,21-22H,7-8,17-20H2,1-3H3,(H,32,35)/b10-4+ |
| InChIKey | GZACDJYZPDXKAA-ONNFQVAWSA-N |
| XLogP | 5.92 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|