C26H29N3O2S — CID 16994838
N-[5-[1-[2-(3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994838) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[5-[1-[2-(3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[2-(3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994838 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[5-[1-[2-(3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(OCCn2c(CCCCCNC(=O)c3cccs3)nc3ccccc32)c1 |
| InChI | InChI=1S/C26H29N3O2S/c1-20-9-7-10-21(19-20)31-17-16-29-23-12-5-4-11-22(23)28-25(29)14-3-2-6-15-27-26(30)24-13-8-18-32-24/h4-5,7-13,18-19H,2-3,6,14-17H2,1H3,(H,27,30) |
| InChIKey | FQFCEDYRRFOPHU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|