C29H35N3O2S — CID 16994883
N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994883) has the molecular formula C29H35N3O2S and a molecular weight of 489.69 g/mol. Its IUPAC name is N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994883 |
| Molecular Formula | C29H35N3O2S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(OCCCCn2c(CCCCCNC(=O)c3cccs3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C29H35N3O2S/c1-22-15-16-26(23(2)21-22)34-19-9-8-18-32-25-12-6-5-11-24(25)31-28(32)14-4-3-7-17-30-29(33)27-13-10-20-35-27/h5-6,10-13,15-16,20-21H,3-4,7-9,14,17-19H2,1-2H3,(H,30,33) |
| InChIKey | WIBYPCUCGZLIOW-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|