C27H35N3O2 — CID 16992291
N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide (PubChem CID 16992291) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide.
| Compound Name | N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 16992291 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCCCc1nc2ccccc2n1CCCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C27H35N3O2/c1-4-27(31)28-17-9-5-6-14-26-29-23-12-7-8-13-24(23)30(26)18-10-11-19-32-25-16-15-21(2)20-22(25)3/h4,7-8,12-13,15-16,20H,1,5-6,9-11,14,17-19H2,2-3H3,(H,28,31) |
| InChIKey | PBZZVXUEEPTCBU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|