C32H38ClN3O2 — CID 16993749
2-(2-chlorophenyl)-N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993749) has the molecular formula C32H38ClN3O2 and a molecular weight of 532.13 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993749 |
| Molecular Formula | C32H38ClN3O2 |
| Molecular Weight | 532.13 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | Cc1ccc(OCCCCn2c(CCCCCNC(=O)Cc3ccccc3Cl)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C32H38ClN3O2/c1-24-17-18-30(25(2)22-24)38-21-11-10-20-36-29-15-8-7-14-28(29)35-31(36)16-4-3-9-19-34-32(37)23-26-12-5-6-13-27(26)33/h5-8,12-15,17-18,22H,3-4,9-11,16,19-21,23H2,1-2H3,(H,34,37) |
| InChIKey | VZKJOPPOVKVOJT-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.13 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|