C33H41N3O2 — CID 16993587
N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(2-methylphenyl)acetamide (PubChem CID 16993587) has the molecular formula C33H41N3O2 and a molecular weight of 511.71 g/mol. Its IUPAC name is N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(2-methylphenyl)acetamide.
| Compound Name | N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16993587 |
| Molecular Formula | C33H41N3O2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | N-[5-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccc(OCCCCn2c(CCCCCNC(=O)Cc3ccccc3C)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C33H41N3O2/c1-25-18-19-31(27(3)23-25)38-22-12-11-21-36-30-16-9-8-15-29(30)35-32(36)17-5-4-10-20-34-33(37)24-28-14-7-6-13-26(28)2/h6-9,13-16,18-19,23H,4-5,10-12,17,20-22,24H2,1-3H3,(H,34,37) |
| InChIKey | VZLIHKMYALWMTF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|