C28H33N3O2S — CID 16994853
N-[5-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994853) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[5-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994853 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[5-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(OCCCn2c(CCCCCNC(=O)c3cccs3)nc3ccccc32)c1C |
| InChI | InChI=1S/C28H33N3O2S/c1-21-11-8-14-25(22(21)2)33-19-10-18-31-24-13-6-5-12-23(24)30-27(31)16-4-3-7-17-29-28(32)26-15-9-20-34-26/h5-6,8-9,11-15,20H,3-4,7,10,16-19H2,1-2H3,(H,29,32) |
| InChIKey | RKHOLIYOEYEWLP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|