C25H27N3O2S — CID 16982084
N-[3-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide (PubChem CID 16982084) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-[3-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16982084 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[3-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(OCCn2c(CCCNC(=O)c3cccs3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H27N3O2S/c1-18-11-12-22(19(2)17-18)30-15-14-28-21-8-4-3-7-20(21)27-24(28)10-5-13-26-25(29)23-9-6-16-31-23/h3-4,6-9,11-12,16-17H,5,10,13-15H2,1-2H3,(H,26,29) |
| InChIKey | PRJIJBUOAGYYGS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|