C25H27N3O2S — CID 16975675
N-[2-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 16975675) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-[2-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16975675 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[2-[1-[4-(3-methylphenoxy)butyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(OCCCCn2c(CCNC(=O)c3cccs3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H27N3O2S/c1-19-8-6-9-20(18-19)30-16-5-4-15-28-22-11-3-2-10-21(22)27-24(28)13-14-26-25(29)23-12-7-17-31-23/h2-3,6-12,17-18H,4-5,13-16H2,1H3,(H,26,29) |
| InChIKey | XFYBOWBEIJSRBS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|