C23H22ClN3O2S — CID 16975651
N-[2-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 16975651) has the molecular formula C23H22ClN3O2S and a molecular weight of 439.97 g/mol. Its IUPAC name is N-[2-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16975651 |
| Molecular Formula | C23H22ClN3O2S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-[2-[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCc1nc2ccccc2n1CCCOc1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C23H22ClN3O2S/c24-17-8-10-18(11-9-17)29-15-4-14-27-20-6-2-1-5-19(20)26-22(27)12-13-25-23(28)21-7-3-16-30-21/h1-3,5-11,16H,4,12-15H2,(H,25,28) |
| InChIKey | ABADCZAYLACRCC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|