C25H29N3O3 — CID 16994134
2-(3,4-dimethoxyphenyl)-N-[5-(1-prop-2-ynylbenzimidazol-2-yl)pentyl]acetamide (PubChem CID 16994134) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-(1-prop-2-ynylbenzimidazol-2-yl)pentyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-(1-prop-2-ynylbenzimidazol-2-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 16994134 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-(1-prop-2-ynylbenzimidazol-2-yl)pentyl]acetamide |
| SMILES | C#CCn1c(CCCCCNC(=O)Cc2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C25H29N3O3/c1-4-16-28-21-11-8-7-10-20(21)27-24(28)12-6-5-9-15-26-25(29)18-19-13-14-22(30-2)23(17-19)31-3/h1,7-8,10-11,13-14,17H,5-6,9,12,15-16,18H2,2-3H3,(H,26,29) |
| InChIKey | RLOPPOREFLLARH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|