C30H35N3O3 — CID 16985694
2-(3,4-dimethoxyphenyl)-N-[3-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide (PubChem CID 16985694) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[3-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[3-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide |
|---|---|
| PubChem CID | 16985694 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[3-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCc2nc3ccccc3n2Cc2c(C)cc(C)cc2C)cc1OC |
| InChI | InChI=1S/C30H35N3O3/c1-20-15-21(2)24(22(3)16-20)19-33-26-10-7-6-9-25(26)32-29(33)11-8-14-31-30(34)18-23-12-13-27(35-4)28(17-23)36-5/h6-7,9-10,12-13,15-17H,8,11,14,18-19H2,1-5H3,(H,31,34) |
| InChIKey | RIUYJCQFLWUDLP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|