C33H41N3O3 — CID 16994166
N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 16994166) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16994166 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | CCC(C)c1ccc(Cn2c(CCCCCNC(=O)Cc3ccc(OC)c(OC)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C33H41N3O3/c1-5-24(2)27-17-14-25(15-18-27)23-36-29-12-9-8-11-28(29)35-32(36)13-7-6-10-20-34-33(37)22-26-16-19-30(38-3)31(21-26)39-4/h8-9,11-12,14-19,21,24H,5-7,10,13,20,22-23H2,1-4H3,(H,34,37) |
| InChIKey | OIJLZFJHTXAEQV-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|