C32H39N3O3 — CID 16990926
N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide (PubChem CID 16990926) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16990926 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide |
| SMILES | CCC(C)c1ccc(Cn2c(CCCCCNC(=O)c3ccc(OC)c(OC)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H39N3O3/c1-5-23(2)25-16-14-24(15-17-25)22-35-28-12-9-8-11-27(28)34-31(35)13-7-6-10-20-33-32(36)26-18-19-29(37-3)30(21-26)38-4/h8-9,11-12,14-19,21,23H,5-7,10,13,20,22H2,1-4H3,(H,33,36) |
| InChIKey | UOUIVINBAHRIQB-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|