C28H29Cl2N3O3 — CID 16990919
N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide (PubChem CID 16990919) has the molecular formula C28H29Cl2N3O3 and a molecular weight of 526.46 g/mol. Its IUPAC name is N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16990919 |
| Molecular Formula | C28H29Cl2N3O3 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCc2nc3ccccc3n2Cc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C28H29Cl2N3O3/c1-35-25-14-12-19(16-26(25)36-2)28(34)31-15-7-3-4-10-27-32-23-8-5-6-9-24(23)33(27)18-20-11-13-21(29)17-22(20)30/h5-6,8-9,11-14,16-17H,3-4,7,10,15,18H2,1-2H3,(H,31,34) |
| InChIKey | AHYIVQMRHOFRGS-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|