C29H31N3O4 — CID 16991042
3,4-dimethoxy-N-[5-(1-phenacylbenzimidazol-2-yl)pentyl]benzamide (PubChem CID 16991042) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[5-(1-phenacylbenzimidazol-2-yl)pentyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[5-(1-phenacylbenzimidazol-2-yl)pentyl]benzamide |
|---|---|
| PubChem CID | 16991042 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3,4-dimethoxy-N-[5-(1-phenacylbenzimidazol-2-yl)pentyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCCCCc2nc3ccccc3n2CC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H31N3O4/c1-35-26-17-16-22(19-27(26)36-2)29(34)30-18-10-4-7-15-28-31-23-13-8-9-14-24(23)32(28)20-25(33)21-11-5-3-6-12-21/h3,5-6,8-9,11-14,16-17,19H,4,7,10,15,18,20H2,1-2H3,(H,30,34) |
| InChIKey | KPKXKYSNZZXCKK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|