C27H28ClN3O3 — CID 16985698
N-[3-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 16985698) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is N-[3-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[3-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16985698 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[3-[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCc2nc3ccccc3n2Cc2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C27H28ClN3O3/c1-33-24-14-13-19(16-25(24)34-2)17-27(32)29-15-7-12-26-30-22-10-5-6-11-23(22)31(26)18-20-8-3-4-9-21(20)28/h3-6,8-11,13-14,16H,7,12,15,17-18H2,1-2H3,(H,29,32) |
| InChIKey | FCFXQZKDRWDKSA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|