C28H33N3OS — CID 16994814
N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994814) has the molecular formula C28H33N3OS and a molecular weight of 459.66 g/mol. Its IUPAC name is N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994814 |
| Molecular Formula | C28H33N3OS |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[5-[1-[(4-butan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | CCC(C)c1ccc(Cn2c(CCCCCNC(=O)c3cccs3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C28H33N3OS/c1-3-21(2)23-16-14-22(15-17-23)20-31-25-11-7-6-10-24(25)30-27(31)13-5-4-8-18-29-28(32)26-12-9-19-33-26/h6-7,9-12,14-17,19,21H,3-5,8,13,18,20H2,1-2H3,(H,29,32) |
| InChIKey | MPDIHJATCPIWBA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|