C24H24BrN3OS — CID 16994810
N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994810) has the molecular formula C24H24BrN3OS and a molecular weight of 482.45 g/mol. Its IUPAC name is N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994810 |
| Molecular Formula | C24H24BrN3OS |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCCCc1nc2ccccc2n1Cc1cccc(Br)c1)c1cccs1 |
| InChI | InChI=1S/C24H24BrN3OS/c25-19-9-6-8-18(16-19)17-28-21-11-4-3-10-20(21)27-23(28)13-2-1-5-14-26-24(29)22-12-7-15-30-22/h3-4,6-12,15-16H,1-2,5,13-14,17H2,(H,26,29) |
| InChIKey | LATCELBDTTZQEZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|