C21H18BrN3OS — CID 16975593
N-[2-[1-[(4-bromophenyl)methyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide (PubChem CID 16975593) has the molecular formula C21H18BrN3OS and a molecular weight of 440.37 g/mol. Its IUPAC name is N-[2-[1-[(4-bromophenyl)methyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[1-[(4-bromophenyl)methyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16975593 |
| Molecular Formula | C21H18BrN3OS |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | N-[2-[1-[(4-bromophenyl)methyl]benzimidazol-2-yl]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCc1nc2ccccc2n1Cc1ccc(Br)cc1)c1cccs1 |
| InChI | InChI=1S/C21H18BrN3OS/c22-16-9-7-15(8-10-16)14-25-18-5-2-1-4-17(18)24-20(25)11-12-23-21(26)19-6-3-13-27-19/h1-10,13H,11-12,14H2,(H,23,26) |
| InChIKey | CFICCIBTTSNLPC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |