C23H23N3O2S — CID 16982069
N-[3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide (PubChem CID 16982069) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16982069 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[3-[1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]propyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(Cn2c(CCCNC(=O)c3cccs3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-28-18-12-10-17(11-13-18)16-26-20-7-3-2-6-19(20)25-22(26)9-4-14-24-23(27)21-8-5-15-29-21/h2-3,5-8,10-13,15H,4,9,14,16H2,1H3,(H,24,27) |
| InChIKey | YRIYPRDBQYUMDY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|