C27H28BrN3O — CID 16990274
N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]-3-methylbenzamide (PubChem CID 16990274) has the molecular formula C27H28BrN3O and a molecular weight of 490.45 g/mol. Its IUPAC name is N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]-3-methylbenzamide.
| Compound Name | N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 16990274 |
| Molecular Formula | C27H28BrN3O |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[5-[1-[(3-bromophenyl)methyl]benzimidazol-2-yl]pentyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCCCCc2nc3ccccc3n2Cc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C27H28BrN3O/c1-20-9-7-11-22(17-20)27(32)29-16-6-2-3-15-26-30-24-13-4-5-14-25(24)31(26)19-21-10-8-12-23(28)18-21/h4-5,7-14,17-18H,2-3,6,15-16,19H2,1H3,(H,29,32) |
| InChIKey | ZFZKFGVCEJSMLG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|