C30H35N3O — CID 16990280
3-methyl-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990280) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-methyl-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-methyl-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990280 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 3-methyl-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCCCCc2nc3ccccc3n2Cc2ccc(C(C)C)cc2)c1 |
| InChI | InChI=1S/C30H35N3O/c1-22(2)25-17-15-24(16-18-25)21-33-28-13-7-6-12-27(28)32-29(33)14-5-4-8-19-31-30(34)26-11-9-10-23(3)20-26/h6-7,9-13,15-18,20,22H,4-5,8,14,19,21H2,1-3H3,(H,31,34) |
| InChIKey | ZUEZEKZDVHXKKB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|