C29H32FN3O — CID 16991738
4-fluoro-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991738) has the molecular formula C29H32FN3O and a molecular weight of 457.59 g/mol. Its IUPAC name is 4-fluoro-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 4-fluoro-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991738 |
| Molecular Formula | C29H32FN3O |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 4-fluoro-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | CC(C)c1ccc(Cn2c(CCCCCNC(=O)c3ccc(F)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H32FN3O/c1-21(2)23-13-11-22(12-14-23)20-33-27-9-6-5-8-26(27)32-28(33)10-4-3-7-19-31-29(34)24-15-17-25(30)18-16-24/h5-6,8-9,11-18,21H,3-4,7,10,19-20H2,1-2H3,(H,31,34) |
| InChIKey | HZLDOUOFPXRJKI-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|