C36H39N3O — CID 16994330
2-(4-phenylphenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994330) has the molecular formula C36H39N3O and a molecular weight of 529.73 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-phenylphenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994330 |
| Molecular Formula | C36H39N3O |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 2-(4-phenylphenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | CC(C)c1ccc(Cn2c(CCCCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C36H39N3O/c1-27(2)30-20-18-29(19-21-30)26-39-34-14-9-8-13-33(34)38-35(39)15-7-4-10-24-37-36(40)25-28-16-22-32(23-17-28)31-11-5-3-6-12-31/h3,5-6,8-9,11-14,16-23,27H,4,7,10,15,24-26H2,1-2H3,(H,37,40) |
| InChIKey | LANUDDZRWRPPRS-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|