C30H34ClN3O — CID 16993844
2-(4-chlorophenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993844) has the molecular formula C30H34ClN3O and a molecular weight of 488.08 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993844 |
| Molecular Formula | C30H34ClN3O |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[5-[1-[(4-propan-2-ylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | CC(C)c1ccc(Cn2c(CCCCCNC(=O)Cc3ccc(Cl)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H34ClN3O/c1-22(2)25-15-11-24(12-16-25)21-34-28-9-6-5-8-27(28)33-29(34)10-4-3-7-19-32-30(35)20-23-13-17-26(31)18-14-23/h5-6,8-9,11-18,22H,3-4,7,10,19-21H2,1-2H3,(H,32,35) |
| InChIKey | GMOXEXVLLOHSLW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|