C25H32ClN3O — CID 16993813
2-(4-chlorophenyl)-N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993813) has the molecular formula C25H32ClN3O and a molecular weight of 426.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993813 |
| Molecular Formula | C25H32ClN3O |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]acetamide |
| SMILES | CC(C)CCn1c(CCCCCNC(=O)Cc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C25H32ClN3O/c1-19(2)15-17-29-23-9-6-5-8-22(23)28-24(29)10-4-3-7-16-27-25(30)18-20-11-13-21(26)14-12-20/h5-6,8-9,11-14,19H,3-4,7,10,15-18H2,1-2H3,(H,27,30) |
| InChIKey | YSVLFPMSQBXXRV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|