C29H32FN3O4 — CID 16991086
N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide (PubChem CID 16991086) has the molecular formula C29H32FN3O4 and a molecular weight of 505.59 g/mol. Its IUPAC name is N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16991086 |
| Molecular Formula | C29H32FN3O4 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCCCc2nc3ccccc3n2Cc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H32FN3O4/c1-35-25-17-21(18-26(36-2)28(25)37-3)29(34)31-16-8-4-5-11-27-32-23-9-6-7-10-24(23)33(27)19-20-12-14-22(30)15-13-20/h6-7,9-10,12-15,17-18H,4-5,8,11,16,19H2,1-3H3,(H,31,34) |
| InChIKey | ZXOJDOQZFPCSJK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|