C32H39N3O4 — CID 16991076
3,4,5-trimethoxy-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991076) has the molecular formula C32H39N3O4 and a molecular weight of 529.68 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991076 |
| Molecular Formula | C32H39N3O4 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | COc1cc(C(=O)NCCCCCc2nc3ccccc3n2Cc2c(C)cc(C)cc2C)cc(OC)c1OC |
| InChI | InChI=1S/C32H39N3O4/c1-21-16-22(2)25(23(3)17-21)20-35-27-13-10-9-12-26(27)34-30(35)14-8-7-11-15-33-32(36)24-18-28(37-4)31(39-6)29(19-24)38-5/h9-10,12-13,16-19H,7-8,11,14-15,20H2,1-6H3,(H,33,36) |
| InChIKey | ONQLGDXHWUHIRD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|