C27H28FN3O4 — CID 16983959
N-[3-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide (PubChem CID 16983959) has the molecular formula C27H28FN3O4 and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[3-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16983959 |
| Molecular Formula | C27H28FN3O4 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[3-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCc2nc3ccccc3n2Cc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H28FN3O4/c1-33-23-15-19(16-24(34-2)26(23)35-3)27(32)29-14-6-9-25-30-21-7-4-5-8-22(21)31(25)17-18-10-12-20(28)13-11-18/h4-5,7-8,10-13,15-16H,6,9,14,17H2,1-3H3,(H,29,32) |
| InChIKey | BRFNHZYWDLLMFQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|