C26H25ClFN3O — CID 16990438
3-chloro-N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990438) has the molecular formula C26H25ClFN3O and a molecular weight of 449.96 g/mol. Its IUPAC name is 3-chloro-N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-chloro-N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990438 |
| Molecular Formula | C26H25ClFN3O |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 3-chloro-N-[5-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | O=C(NCCCCCc1nc2ccccc2n1Cc1ccc(F)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H25ClFN3O/c27-21-8-6-7-20(17-21)26(32)29-16-5-1-2-11-25-30-23-9-3-4-10-24(23)31(25)18-19-12-14-22(28)15-13-19/h3-4,6-10,12-15,17H,1-2,5,11,16,18H2,(H,29,32) |
| InChIKey | KIJTYLLAASXVID-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|