C24H30ClN3O — CID 16990410
3-chloro-N-[5-[1-(2-methylbutyl)benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990410) has the molecular formula C24H30ClN3O and a molecular weight of 411.98 g/mol. Its IUPAC name is 3-chloro-N-[5-[1-(2-methylbutyl)benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-chloro-N-[5-[1-(2-methylbutyl)benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990410 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 3-chloro-N-[5-[1-(2-methylbutyl)benzimidazol-2-yl]pentyl]benzamide |
| SMILES | CCC(C)Cn1c(CCCCCNC(=O)c2cccc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H30ClN3O/c1-3-18(2)17-28-22-13-7-6-12-21(22)27-23(28)14-5-4-8-15-26-24(29)19-10-9-11-20(25)16-19/h6-7,9-13,16,18H,3-5,8,14-15,17H2,1-2H3,(H,26,29) |
| InChIKey | HAEMIBUMTGWRBL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|