C29H32ClN3O2 — CID 16990456
3-chloro-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990456) has the molecular formula C29H32ClN3O2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 3-chloro-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3-chloro-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990456 |
| Molecular Formula | C29H32ClN3O2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-chloro-N-[5-[1-[2-(2,6-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1cccc(C)c1OCCn1c(CCCCCNC(=O)c2cccc(Cl)c2)nc2ccccc21 |
| InChI | InChI=1S/C29H32ClN3O2/c1-21-10-8-11-22(2)28(21)35-19-18-33-26-15-6-5-14-25(26)32-27(33)16-4-3-7-17-31-29(34)23-12-9-13-24(30)20-23/h5-6,8-15,20H,3-4,7,16-19H2,1-2H3,(H,31,34) |
| InChIKey | IIERVDFRPDKAHX-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|