C31H36ClN3O2 — CID 16990473
N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide (PubChem CID 16990473) has the molecular formula C31H36ClN3O2 and a molecular weight of 518.10 g/mol. Its IUPAC name is N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide.
| Compound Name | N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide |
|---|---|
| PubChem CID | 16990473 |
| Molecular Formula | C31H36ClN3O2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3-chlorobenzamide |
| SMILES | CC(C)(C)c1ccc(OCCn2c(CCCCCNC(=O)c3cccc(Cl)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H36ClN3O2/c1-31(2,3)24-15-17-26(18-16-24)37-21-20-35-28-13-7-6-12-27(28)34-29(35)14-5-4-8-19-33-30(36)23-10-9-11-25(32)22-23/h6-7,9-13,15-18,22H,4-5,8,14,19-21H2,1-3H3,(H,33,36) |
| InChIKey | ZGMYOZRRNGTORQ-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|