C31H36BrN3O2 — CID 16991607
4-bromo-N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991607) has the molecular formula C31H36BrN3O2 and a molecular weight of 562.55 g/mol. Its IUPAC name is 4-bromo-N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 4-bromo-N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991607 |
| Molecular Formula | C31H36BrN3O2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 4-bromo-N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | CC(C)(C)c1ccc(OCCn2c(CCCCCNC(=O)c3ccc(Br)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H36BrN3O2/c1-31(2,3)24-14-18-26(19-15-24)37-22-21-35-28-10-7-6-9-27(28)34-29(35)11-5-4-8-20-33-30(36)23-12-16-25(32)17-13-23/h6-7,9-10,12-19H,4-5,8,11,20-22H2,1-3H3,(H,33,36) |
| InChIKey | FMJQRLKBESVOPF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|