C31H36FN3O2 — CID 16989987
N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide (PubChem CID 16989987) has the molecular formula C31H36FN3O2 and a molecular weight of 501.65 g/mol. Its IUPAC name is N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide.
| Compound Name | N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 16989987 |
| Molecular Formula | C31H36FN3O2 |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | N-[5-[1-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide |
| SMILES | CC(C)(C)c1ccc(OCCn2c(CCCCCNC(=O)c3ccccc3F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H36FN3O2/c1-31(2,3)23-16-18-24(19-17-23)37-22-21-35-28-14-9-8-13-27(28)34-29(35)15-5-4-10-20-33-30(36)25-11-6-7-12-26(25)32/h6-9,11-14,16-19H,4-5,10,15,20-22H2,1-3H3,(H,33,36) |
| InChIKey | NGCAZUNBHYZFNW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|