C32H38FN3O2 — CID 16990013
N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide (PubChem CID 16990013) has the molecular formula C32H38FN3O2 and a molecular weight of 515.67 g/mol. Its IUPAC name is N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide.
| Compound Name | N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 16990013 |
| Molecular Formula | C32H38FN3O2 |
| Molecular Weight | 515.67 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-fluorobenzamide |
| SMILES | CCC(C)c1ccc(OCCCn2c(CCCCCNC(=O)c3ccccc3F)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H38FN3O2/c1-3-24(2)25-17-19-26(20-18-25)38-23-11-22-36-30-15-9-8-14-29(30)35-31(36)16-5-4-10-21-34-32(37)27-12-6-7-13-28(27)33/h6-9,12-15,17-20,24H,3-5,10-11,16,21-23H2,1-2H3,(H,34,37) |
| InChIKey | WVTQVYLSDREPLE-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|