C33H41N3O3 — CID 16990175
N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-methoxybenzamide (PubChem CID 16990175) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-methoxybenzamide.
| Compound Name | N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 16990175 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | N-[5-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]pentyl]-2-methoxybenzamide |
| SMILES | CCC(C)c1ccc(OCCCn2c(CCCCCNC(=O)c3ccccc3OC)nc3ccccc32)cc1 |
| InChI | InChI=1S/C33H41N3O3/c1-4-25(2)26-18-20-27(21-19-26)39-24-12-23-36-30-15-9-8-14-29(30)35-32(36)17-6-5-11-22-34-33(37)28-13-7-10-16-31(28)38-3/h7-10,13-16,18-21,25H,4-6,11-12,17,22-24H2,1-3H3,(H,34,37) |
| InChIKey | WRGWWRZQVXGIQX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|