C32H39N3O2 — CID 16982600
N-[3-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide (PubChem CID 16982600) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is N-[3-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide.
| Compound Name | N-[3-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 16982600 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | N-[3-[1-[3-(4-butan-2-ylphenoxy)propyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide |
| SMILES | CCC(C)c1ccc(OCCCn2c(CCCNC(=O)c3ccc(C)cc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H39N3O2/c1-5-24(3)26-14-16-27(17-15-26)37-21-9-20-35-30-11-7-6-10-29(30)34-31(35)12-8-19-33-32(36)28-18-13-23(2)22-25(28)4/h6-7,10-11,13-18,22,24H,5,8-9,12,19-21H2,1-4H3,(H,33,36) |
| InChIKey | VSOYQQJKJNBVCP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|