C28H39N3O2 — CID 16981018
N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-ethylbutanamide (PubChem CID 16981018) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-ethylbutanamide.
| Compound Name | N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 16981018 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCCc1nc2ccccc2n1CCOc1ccc(C(C)CC)cc1 |
| InChI | InChI=1S/C28H39N3O2/c1-5-21(4)23-14-16-24(17-15-23)33-20-19-31-26-12-9-8-11-25(26)30-27(31)13-10-18-29-28(32)22(6-2)7-3/h8-9,11-12,14-17,21-22H,5-7,10,13,18-20H2,1-4H3,(H,29,32) |
| InChIKey | NUAZKDAURPSTDN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|