C36H39N3O2 — CID 16985900
N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16985900) has the molecular formula C36H39N3O2 and a molecular weight of 545.73 g/mol. Its IUPAC name is N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16985900 |
| Molecular Formula | C36H39N3O2 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(OCCn2c(CCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C36H39N3O2/c1-3-27(2)29-19-21-32(22-20-29)41-25-24-39-34-13-8-7-12-33(34)38-35(39)14-9-23-37-36(40)26-28-15-17-31(18-16-28)30-10-5-4-6-11-30/h4-8,10-13,15-22,27H,3,9,14,23-26H2,1-2H3,(H,37,40) |
| InChIKey | BLPPWKXVMFILAX-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|