C29H32FN3O2 — CID 16984469
N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-4-fluorobenzamide (PubChem CID 16984469) has the molecular formula C29H32FN3O2 and a molecular weight of 473.59 g/mol. Its IUPAC name is N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-4-fluorobenzamide.
| Compound Name | N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 16984469 |
| Molecular Formula | C29H32FN3O2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[3-[1-[2-(4-butan-2-ylphenoxy)ethyl]benzimidazol-2-yl]propyl]-4-fluorobenzamide |
| SMILES | CCC(C)c1ccc(OCCn2c(CCCNC(=O)c3ccc(F)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H32FN3O2/c1-3-21(2)22-12-16-25(17-13-22)35-20-19-33-27-8-5-4-7-26(27)32-28(33)9-6-18-31-29(34)23-10-14-24(30)15-11-23/h4-5,7-8,10-17,21H,3,6,9,18-20H2,1-2H3,(H,31,34) |
| InChIKey | IHMFVQQNJSJKJL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|