C34H43N3O3 — CID 16991339
N-[5-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide (PubChem CID 16991339) has the molecular formula C34H43N3O3 and a molecular weight of 541.74 g/mol. Its IUPAC name is N-[5-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide.
| Compound Name | N-[5-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 16991339 |
| Molecular Formula | C34H43N3O3 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | N-[5-[1-[4-(4-butan-2-ylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide |
| SMILES | CCC(C)c1ccc(OCCCCn2c(CCCCCNC(=O)c3ccc(OC)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C34H43N3O3/c1-4-26(2)27-15-21-30(22-16-27)40-25-11-10-24-37-32-13-8-7-12-31(32)36-33(37)14-6-5-9-23-35-34(38)28-17-19-29(39-3)20-18-28/h7-8,12-13,15-22,26H,4-6,9-11,14,23-25H2,1-3H3,(H,35,38) |
| InChIKey | LBZLEQCMISHSOV-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|